C23H36N4O5 — CID 11476419
(2S)-N-(2-cyclopentylethyl)-N-[2-(hydroxyamino)-2-oxoethyl]-2-[(2-methoxyphenyl)carbamoylamino]-3,3-dimethylbutanamide (PubChem CID 11476419) has the molecular formula C23H36N4O5 and a molecular weight of 448.56 g/mol. Its IUPAC name is (2S)-N-(2-cyclopentylethyl)-N-[2-(hydroxyamino)-2-oxoethyl]-2-[(2-methoxyphenyl)carbamoylamino]-3,3-dimethylbutanamide.
| Compound Name | (2S)-N-(2-cyclopentylethyl)-N-[2-(hydroxyamino)-2-oxoethyl]-2-[(2-methoxyphenyl)carbamoylamino]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 11476419 |
| Molecular Formula | C23H36N4O5 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.27 |
| IUPAC Name | (2S)-N-(2-cyclopentylethyl)-N-[2-(hydroxyamino)-2-oxoethyl]-2-[(2-methoxyphenyl)carbamoylamino]-3,3-dimethylbutanamide |
| SMILES | COc1ccccc1NC(=O)N[C@H](C(=O)N(CCC1CCCC1)CC(=O)NO)C(C)(C)C |
| InChI | InChI=1S/C23H36N4O5/c1-23(2,3)20(25-22(30)24-17-11-7-8-12-18(17)32-4)21(29)27(15-19(28)26-31)14-13-16-9-5-6-10-16/h7-8,11-12,16,20,31H,5-6,9-10,13-15H2,1-4H3,(H,26,28)(H2,24,25,30)/t20-/m1/s1 |
| InChIKey | HNSGWMSGWTXUNT-HXUWFJFHSA-N |
| XLogP | 3.15 |
| TPSA | 120.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|