C22H32Cl2N4O4 — CID 11420377
(2S)-N-(2-cyclopentylethyl)-2-[(2,4-dichlorophenyl)carbamoylamino]-N-[2-(hydroxyamino)-2-oxoethyl]-3,3-dimethylbutanamide (PubChem CID 11420377) has the molecular formula C22H32Cl2N4O4 and a molecular weight of 487.43 g/mol. Its IUPAC name is (2S)-N-(2-cyclopentylethyl)-2-[(2,4-dichlorophenyl)carbamoylamino]-N-[2-(hydroxyamino)-2-oxoethyl]-3,3-dimethylbutanamide.
| Compound Name | (2S)-N-(2-cyclopentylethyl)-2-[(2,4-dichlorophenyl)carbamoylamino]-N-[2-(hydroxyamino)-2-oxoethyl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 11420377 |
| Molecular Formula | C22H32Cl2N4O4 |
| Molecular Weight | 487.43 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | (2S)-N-(2-cyclopentylethyl)-2-[(2,4-dichlorophenyl)carbamoylamino]-N-[2-(hydroxyamino)-2-oxoethyl]-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)[C@H](NC(=O)Nc1ccc(Cl)cc1Cl)C(=O)N(CCC1CCCC1)CC(=O)NO |
| InChI | InChI=1S/C22H32Cl2N4O4/c1-22(2,3)19(26-21(31)25-17-9-8-15(23)12-16(17)24)20(30)28(13-18(29)27-32)11-10-14-6-4-5-7-14/h8-9,12,14,19,32H,4-7,10-11,13H2,1-3H3,(H,27,29)(H2,25,26,31)/t19-/m1/s1 |
| InChIKey | XEUOBEWTWWZEBN-LJQANCHMSA-N |
| XLogP | 4.44 |
| TPSA | 110.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.43 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|