C26H41N5O4 — CID 91054696
N-(cyclopentylmethyl)-N-[2-(hydroxyamino)-2-oxoethyl]-3,3-dimethyl-2-[(2-piperidin-1-ylphenyl)carbamoylamino]butanamide (PubChem CID 91054696) has the molecular formula C26H41N5O4 and a molecular weight of 487.65 g/mol. Its IUPAC name is N-(cyclopentylmethyl)-N-[2-(hydroxyamino)-2-oxoethyl]-3,3-dimethyl-2-[(2-piperidin-1-ylphenyl)carbamoylamino]butanamide.
| Compound Name | N-(cyclopentylmethyl)-N-[2-(hydroxyamino)-2-oxoethyl]-3,3-dimethyl-2-[(2-piperidin-1-ylphenyl)carbamoylamino]butanamide |
|---|---|
| PubChem CID | 91054696 |
| Molecular Formula | C26H41N5O4 |
| Molecular Weight | 487.65 g/mol |
| Exact Mass | 487.32 |
| IUPAC Name | N-(cyclopentylmethyl)-N-[2-(hydroxyamino)-2-oxoethyl]-3,3-dimethyl-2-[(2-piperidin-1-ylphenyl)carbamoylamino]butanamide |
| SMILES | CC(C)(C)C(NC(=O)Nc1ccccc1N1CCCCC1)C(=O)N(CC(=O)NO)CC1CCCC1 |
| InChI | InChI=1S/C26H41N5O4/c1-26(2,3)23(24(33)31(18-22(32)29-35)17-19-11-5-6-12-19)28-25(34)27-20-13-7-8-14-21(20)30-15-9-4-10-16-30/h7-8,13-14,19,23,35H,4-6,9-12,15-18H2,1-3H3,(H,29,32)(H2,27,28,34) |
| InChIKey | UBUASOKBSSIFIX-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 114.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.65 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|