C19H26Cl2N4O4 — CID 11362804
(2S)-N-(cyclobutylmethyl)-2-[(3,4-dichlorophenyl)carbamoylamino]-N-[2-(hydroxyamino)-2-oxoethyl]-3-methylbutanamide (PubChem CID 11362804) has the molecular formula C19H26Cl2N4O4 and a molecular weight of 445.35 g/mol. Its IUPAC name is (2S)-N-(cyclobutylmethyl)-2-[(3,4-dichlorophenyl)carbamoylamino]-N-[2-(hydroxyamino)-2-oxoethyl]-3-methylbutanamide.
| Compound Name | (2S)-N-(cyclobutylmethyl)-2-[(3,4-dichlorophenyl)carbamoylamino]-N-[2-(hydroxyamino)-2-oxoethyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 11362804 |
| Molecular Formula | C19H26Cl2N4O4 |
| Molecular Weight | 445.35 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | (2S)-N-(cyclobutylmethyl)-2-[(3,4-dichlorophenyl)carbamoylamino]-N-[2-(hydroxyamino)-2-oxoethyl]-3-methylbutanamide |
| SMILES | CC(C)[C@H](NC(=O)Nc1ccc(Cl)c(Cl)c1)C(=O)N(CC(=O)NO)CC1CCC1 |
| InChI | InChI=1S/C19H26Cl2N4O4/c1-11(2)17(23-19(28)22-13-6-7-14(20)15(21)8-13)18(27)25(10-16(26)24-29)9-12-4-3-5-12/h6-8,11-12,17,29H,3-5,9-10H2,1-2H3,(H,24,26)(H2,22,23,28)/t17-/m0/s1 |
| InChIKey | IEXJIKMRYGXDTE-KRWDZBQOSA-N |
| XLogP | 3.27 |
| TPSA | 110.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.35 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|