C17H18N6OS — CID 72843319
7,7-dimethyl-2-[(2-pyrazin-2-yl-1,3-thiazol-4-yl)methyl]-1,5,6,8-tetrahydroimidazo[4,5-c]azepin-4-one (PubChem CID 72843319) has the molecular formula C17H18N6OS and a molecular weight of 354.44 g/mol. Its IUPAC name is 7,7-dimethyl-2-[(2-pyrazin-2-yl-1,3-thiazol-4-yl)methyl]-1,5,6,8-tetrahydroimidazo[4,5-c]azepin-4-one.
| Compound Name | 7,7-dimethyl-2-[(2-pyrazin-2-yl-1,3-thiazol-4-yl)methyl]-1,5,6,8-tetrahydroimidazo[4,5-c]azepin-4-one |
|---|---|
| PubChem CID | 72843319 |
| Molecular Formula | C17H18N6OS |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | 7,7-dimethyl-2-[(2-pyrazin-2-yl-1,3-thiazol-4-yl)methyl]-1,5,6,8-tetrahydroimidazo[4,5-c]azepin-4-one |
| SMILES | CC1(C)CNC(=O)c2nc(Cc3csc(-c4cnccn4)n3)[nH]c2C1 |
| InChI | InChI=1S/C17H18N6OS/c1-17(2)6-11-14(15(24)20-9-17)23-13(22-11)5-10-8-25-16(21-10)12-7-18-3-4-19-12/h3-4,7-8H,5-6,9H2,1-2H3,(H,20,24)(H,22,23) |
| InChIKey | AZEMXKNLINLQJS-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |