C12H12N4O3S — CID 728586
benzyl 2-[(5-oxo-3-sulfanylidene-2H-1,2,4-triazin-6-yl)amino]acetate (PubChem CID 728586) has the molecular formula C12H12N4O3S and a molecular weight of 292.32 g/mol. Its IUPAC name is benzyl 2-[(5-oxo-3-sulfanylidene-2H-1,2,4-triazin-6-yl)amino]acetate.
| Compound Name | benzyl 2-[(5-oxo-3-sulfanylidene-2H-1,2,4-triazin-6-yl)amino]acetate |
|---|---|
| PubChem CID | 728586 |
| Molecular Formula | C12H12N4O3S |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | benzyl 2-[(5-oxo-3-sulfanylidene-2H-1,2,4-triazin-6-yl)amino]acetate |
| SMILES | O=C(CNc1n[nH]c(=S)[nH]c1=O)OCc1ccccc1 |
| InChI | InChI=1S/C12H12N4O3S/c17-9(19-7-8-4-2-1-3-5-8)6-13-10-11(18)14-12(20)16-15-10/h1-5H,6-7H2,(H,13,15)(H2,14,16,18,20) |
| InChIKey | WMSNTBKZKIFHHK-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 99.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|