C21H26N2O2 — CID 72877838
1-[3-[(7-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]phenyl]piperazine (PubChem CID 72877838) has the molecular formula C21H26N2O2 and a molecular weight of 338.45 g/mol. Its IUPAC name is 1-[3-[(7-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]phenyl]piperazine.
| Compound Name | 1-[3-[(7-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]phenyl]piperazine |
|---|---|
| PubChem CID | 72877838 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 1-[3-[(7-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]phenyl]piperazine |
| SMILES | COc1ccc2c(c1)OCC(Cc1cccc(N3CCNCC3)c1)C2 |
| InChI | InChI=1S/C21H26N2O2/c1-24-20-6-5-18-12-17(15-25-21(18)14-20)11-16-3-2-4-19(13-16)23-9-7-22-8-10-23/h2-6,13-14,17,22H,7-12,15H2,1H3 |
| InChIKey | SHBHOITWEOSBFY-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |