C12H14F2N2O — CID 72880848
1-(2-cyclopropylphenyl)-3-(2,2-difluoroethyl)urea (PubChem CID 72880848) has the molecular formula C12H14F2N2O and a molecular weight of 240.25 g/mol. Its IUPAC name is 1-(2-cyclopropylphenyl)-3-(2,2-difluoroethyl)urea.
| Compound Name | 1-(2-cyclopropylphenyl)-3-(2,2-difluoroethyl)urea |
|---|---|
| PubChem CID | 72880848 |
| Molecular Formula | C12H14F2N2O |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 1-(2-cyclopropylphenyl)-3-(2,2-difluoroethyl)urea |
| SMILES | O=C(NCC(F)F)Nc1ccccc1C1CC1 |
| InChI | InChI=1S/C12H14F2N2O/c13-11(14)7-15-12(17)16-10-4-2-1-3-9(10)8-5-6-8/h1-4,8,11H,5-7H2,(H2,15,16,17) |
| InChIKey | FECFINBPOPCGDP-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |