C20H25N7O — CID 72885761
1-methyl-3-[2-methyl-3-(4-methyl-1,2,4-triazol-3-yl)phenyl]-1-(4,5,6,7-tetrahydro-1H-indazol-3-ylmethyl)urea (PubChem CID 72885761) has the molecular formula C20H25N7O and a molecular weight of 379.47 g/mol. Its IUPAC name is 1-methyl-3-[2-methyl-3-(4-methyl-1,2,4-triazol-3-yl)phenyl]-1-(4,5,6,7-tetrahydro-1H-indazol-3-ylmethyl)urea.
| Compound Name | 1-methyl-3-[2-methyl-3-(4-methyl-1,2,4-triazol-3-yl)phenyl]-1-(4,5,6,7-tetrahydro-1H-indazol-3-ylmethyl)urea |
|---|---|
| PubChem CID | 72885761 |
| Molecular Formula | C20H25N7O |
| Molecular Weight | 379.47 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | 1-methyl-3-[2-methyl-3-(4-methyl-1,2,4-triazol-3-yl)phenyl]-1-(4,5,6,7-tetrahydro-1H-indazol-3-ylmethyl)urea |
| SMILES | Cc1c(NC(=O)N(C)Cc2n[nH]c3c2CCCC3)cccc1-c1nncn1C |
| InChI | InChI=1S/C20H25N7O/c1-13-14(19-25-21-12-27(19)3)8-6-10-16(13)22-20(28)26(2)11-18-15-7-4-5-9-17(15)23-24-18/h6,8,10,12H,4-5,7,9,11H2,1-3H3,(H,22,28)(H,23,24) |
| InChIKey | YYTRTAMJSDPQIU-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 91.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.47 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |