C18H22N5O+ — CID 72889625
6-ethyl-N-[[5-(4-methoxyphenyl)-1H-pyrazol-4-yl]methyl]-5-methyl-1H-pyrimidin-3-ium-2-amine (PubChem CID 72889625) has the molecular formula C18H22N5O+ and a molecular weight of 324.41 g/mol. Its IUPAC name is 6-ethyl-N-[[5-(4-methoxyphenyl)-1H-pyrazol-4-yl]methyl]-5-methyl-1H-pyrimidin-3-ium-2-amine.
| Compound Name | 6-ethyl-N-[[5-(4-methoxyphenyl)-1H-pyrazol-4-yl]methyl]-5-methyl-1H-pyrimidin-3-ium-2-amine |
|---|---|
| PubChem CID | 72889625 |
| Molecular Formula | C18H22N5O+ |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 6-ethyl-N-[[5-(4-methoxyphenyl)-1H-pyrazol-4-yl]methyl]-5-methyl-1H-pyrimidin-3-ium-2-amine |
| SMILES | CCC1=C(C)C=[N+]=C(NCc2cn[nH]c2-c2ccc(OC)cc2)N1 |
| InChI | InChI=1S/C18H21N5O/c1-4-16-12(2)9-19-18(22-16)20-10-14-11-21-23-17(14)13-5-7-15(24-3)8-6-13/h5-9,11H,4,10H2,1-3H3,(H2,19,20,21,22,23)/p+1 |
| InChIKey | GPTDOCHXCHBFHI-UHFFFAOYSA-O |
| XLogP | 1.96 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|