C14H25N5O2S — CID 72893402
(4aS,7aR)-4-(2-methylpropyl)-1-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide (PubChem CID 72893402) has the molecular formula C14H25N5O2S and a molecular weight of 327.45 g/mol. Its IUPAC name is (4aS,7aR)-4-(2-methylpropyl)-1-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide.
| Compound Name | (4aS,7aR)-4-(2-methylpropyl)-1-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide |
|---|---|
| PubChem CID | 72893402 |
| Molecular Formula | C14H25N5O2S |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | (4aS,7aR)-4-(2-methylpropyl)-1-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide |
| SMILES | Cc1nc(CN2CCN(CC(C)C)[C@@H]3CS(=O)(=O)C[C@@H]32)n[nH]1 |
| InChI | InChI=1S/C14H25N5O2S/c1-10(2)6-18-4-5-19(7-14-15-11(3)16-17-14)13-9-22(20,21)8-12(13)18/h10,12-13H,4-9H2,1-3H3,(H,15,16,17)/t12-,13+/m1/s1 |
| InChIKey | VWWPWOGPOPDMRS-OLZOCXBDSA-N |
| XLogP | 0.05 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |