C15H14FN3O2 — CID 72902714
5-(5-fluoro-1-methylindol-2-yl)-3-(oxolan-3-yl)-1,2,4-oxadiazole (PubChem CID 72902714) has the molecular formula C15H14FN3O2 and a molecular weight of 287.29 g/mol. Its IUPAC name is 5-(5-fluoro-1-methylindol-2-yl)-3-(oxolan-3-yl)-1,2,4-oxadiazole.
| Compound Name | 5-(5-fluoro-1-methylindol-2-yl)-3-(oxolan-3-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 72902714 |
| Molecular Formula | C15H14FN3O2 |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 5-(5-fluoro-1-methylindol-2-yl)-3-(oxolan-3-yl)-1,2,4-oxadiazole |
| SMILES | Cn1c(-c2nc(C3CCOC3)no2)cc2cc(F)ccc21 |
| InChI | InChI=1S/C15H14FN3O2/c1-19-12-3-2-11(16)6-10(12)7-13(19)15-17-14(18-21-15)9-4-5-20-8-9/h2-3,6-7,9H,4-5,8H2,1H3 |
| InChIKey | AHYXSAQDWVXDPF-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 53.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |