C15H14ClN3O2 — CID 97446011
5-(6-chloro-1-methylindol-2-yl)-3-[(3R)-oxolan-3-yl]-1,2,4-oxadiazole (PubChem CID 97446011) has the molecular formula C15H14ClN3O2 and a molecular weight of 303.75 g/mol. Its IUPAC name is 5-(6-chloro-1-methylindol-2-yl)-3-[(3R)-oxolan-3-yl]-1,2,4-oxadiazole.
| Compound Name | 5-(6-chloro-1-methylindol-2-yl)-3-[(3R)-oxolan-3-yl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 97446011 |
| Molecular Formula | C15H14ClN3O2 |
| Molecular Weight | 303.75 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 5-(6-chloro-1-methylindol-2-yl)-3-[(3R)-oxolan-3-yl]-1,2,4-oxadiazole |
| SMILES | Cn1c(-c2nc([C@H]3CCOC3)no2)cc2ccc(Cl)cc21 |
| InChI | InChI=1S/C15H14ClN3O2/c1-19-12-7-11(16)3-2-9(12)6-13(19)15-17-14(18-21-15)10-4-5-20-8-10/h2-3,6-7,10H,4-5,8H2,1H3/t10-/m0/s1 |
| InChIKey | TVKNISZYKZDZFL-JTQLQIEISA-N |
| XLogP | 3.39 |
| TPSA | 53.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.75 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |