C14H20N3O3+ — CID 7290501
(Z,2R,5S)-1,2,5-trimethyl-N-(4-nitrophenoxy)piperidin-1-ium-4-imine (PubChem CID 7290501) has the molecular formula C14H20N3O3+ and a molecular weight of 278.33 g/mol. Its IUPAC name is (Z,2R,5S)-1,2,5-trimethyl-N-(4-nitrophenoxy)piperidin-1-ium-4-imine.
| Compound Name | (Z,2R,5S)-1,2,5-trimethyl-N-(4-nitrophenoxy)piperidin-1-ium-4-imine |
|---|---|
| PubChem CID | 7290501 |
| Molecular Formula | C14H20N3O3+ |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | (Z,2R,5S)-1,2,5-trimethyl-N-(4-nitrophenoxy)piperidin-1-ium-4-imine |
| SMILES | C[C@@H]1C/C(=N/Oc2ccc([N+](=O)[O-])cc2)[C@@H](C)C[NH+]1C |
| InChI | InChI=1S/C14H19N3O3/c1-10-9-16(3)11(2)8-14(10)15-20-13-6-4-12(5-7-13)17(18)19/h4-7,10-11H,8-9H2,1-3H3/p+1/b15-14-/t10-,11+/m0/s1 |
| InChIKey | YLUPTEYKJCDJHX-PPRBZMNOSA-O |
| XLogP | 1.27 |
| TPSA | 69.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|