C13H23N5S — CID 72908836
6-[3-(aminomethyl)pyrrolidin-1-yl]-2-butylsulfanylpyrimidin-4-amine (PubChem CID 72908836) has the molecular formula C13H23N5S and a molecular weight of 281.43 g/mol. Its IUPAC name is 6-[3-(aminomethyl)pyrrolidin-1-yl]-2-butylsulfanylpyrimidin-4-amine.
| Compound Name | 6-[3-(aminomethyl)pyrrolidin-1-yl]-2-butylsulfanylpyrimidin-4-amine |
|---|---|
| PubChem CID | 72908836 |
| Molecular Formula | C13H23N5S |
| Molecular Weight | 281.43 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 6-[3-(aminomethyl)pyrrolidin-1-yl]-2-butylsulfanylpyrimidin-4-amine |
| SMILES | CCCCSc1nc(N)cc(N2CCC(CN)C2)n1 |
| InChI | InChI=1S/C13H23N5S/c1-2-3-6-19-13-16-11(15)7-12(17-13)18-5-4-10(8-14)9-18/h7,10H,2-6,8-9,14H2,1H3,(H2,15,16,17) |
| InChIKey | ZTNLADYXNAAHPR-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.43 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|