C17H25N7OS — CID 72913791
5-[4-(6-amino-2-butylsulfanylpyrimidin-4-yl)piperazin-1-yl]-2-methylpyridazin-3-one (PubChem CID 72913791) has the molecular formula C17H25N7OS and a molecular weight of 375.50 g/mol. Its IUPAC name is 5-[4-(6-amino-2-butylsulfanylpyrimidin-4-yl)piperazin-1-yl]-2-methylpyridazin-3-one.
| Compound Name | 5-[4-(6-amino-2-butylsulfanylpyrimidin-4-yl)piperazin-1-yl]-2-methylpyridazin-3-one |
|---|---|
| PubChem CID | 72913791 |
| Molecular Formula | C17H25N7OS |
| Molecular Weight | 375.50 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 5-[4-(6-amino-2-butylsulfanylpyrimidin-4-yl)piperazin-1-yl]-2-methylpyridazin-3-one |
| SMILES | CCCCSc1nc(N)cc(N2CCN(c3cnn(C)c(=O)c3)CC2)n1 |
| InChI | InChI=1S/C17H25N7OS/c1-3-4-9-26-17-20-14(18)11-15(21-17)24-7-5-23(6-8-24)13-10-16(25)22(2)19-12-13/h10-12H,3-9H2,1-2H3,(H2,18,20,21) |
| InChIKey | VMFZTDSVRWJXBY-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.50 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|