C15H23N5OS — CID 133130079
(1S,5R)-3-(6-amino-2-butylsulfanylpyrimidin-4-yl)-3,6-diazabicyclo[3.2.2]nonan-7-one (PubChem CID 133130079) has the molecular formula C15H23N5OS and a molecular weight of 321.45 g/mol. Its IUPAC name is (1S,5R)-3-(6-amino-2-butylsulfanylpyrimidin-4-yl)-3,6-diazabicyclo[3.2.2]nonan-7-one.
| Compound Name | (1S,5R)-3-(6-amino-2-butylsulfanylpyrimidin-4-yl)-3,6-diazabicyclo[3.2.2]nonan-7-one |
|---|---|
| PubChem CID | 133130079 |
| Molecular Formula | C15H23N5OS |
| Molecular Weight | 321.45 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | (1S,5R)-3-(6-amino-2-butylsulfanylpyrimidin-4-yl)-3,6-diazabicyclo[3.2.2]nonan-7-one |
| SMILES | CCCCSc1nc(N)cc(N2C[C@H]3CC[C@@H](C2)C(=O)N3)n1 |
| InChI | InChI=1S/C15H23N5OS/c1-2-3-6-22-15-18-12(16)7-13(19-15)20-8-10-4-5-11(9-20)17-14(10)21/h7,10-11H,2-6,8-9H2,1H3,(H,17,21)(H2,16,18,19)/t10-,11+/m0/s1 |
| InChIKey | DATOYGUXLVGLDI-WDEREUQCSA-N |
| XLogP | 1.67 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.45 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|