C15H25N5OS — CID 97198180
(4R)-4-[[(6-amino-2-butylsulfanylpyrimidin-4-yl)-methylamino]methyl]-1-methylpyrrolidin-2-one (PubChem CID 97198180) has the molecular formula C15H25N5OS and a molecular weight of 323.47 g/mol. Its IUPAC name is (4R)-4-[[(6-amino-2-butylsulfanylpyrimidin-4-yl)-methylamino]methyl]-1-methylpyrrolidin-2-one.
| Compound Name | (4R)-4-[[(6-amino-2-butylsulfanylpyrimidin-4-yl)-methylamino]methyl]-1-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 97198180 |
| Molecular Formula | C15H25N5OS |
| Molecular Weight | 323.47 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | (4R)-4-[[(6-amino-2-butylsulfanylpyrimidin-4-yl)-methylamino]methyl]-1-methylpyrrolidin-2-one |
| SMILES | CCCCSc1nc(N)cc(N(C)C[C@H]2CC(=O)N(C)C2)n1 |
| InChI | InChI=1S/C15H25N5OS/c1-4-5-6-22-15-17-12(16)8-13(18-15)19(2)9-11-7-14(21)20(3)10-11/h8,11H,4-7,9-10H2,1-3H3,(H2,16,17,18)/t11-/m1/s1 |
| InChIKey | JIXSDVNQTSFKJE-LLVKDONJSA-N |
| XLogP | 1.87 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.47 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|