C16H28N6S — CID 72881753
2-butylsulfanyl-6-(8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl)pyrimidin-4-amine (PubChem CID 72881753) has the molecular formula C16H28N6S and a molecular weight of 336.51 g/mol. Its IUPAC name is 2-butylsulfanyl-6-(8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl)pyrimidin-4-amine.
| Compound Name | 2-butylsulfanyl-6-(8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 72881753 |
| Molecular Formula | C16H28N6S |
| Molecular Weight | 336.51 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | 2-butylsulfanyl-6-(8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl)pyrimidin-4-amine |
| SMILES | CCCCSc1nc(N)cc(N2CCN3CCN(C)CC3C2)n1 |
| InChI | InChI=1S/C16H28N6S/c1-3-4-9-23-16-18-14(17)10-15(19-16)22-8-7-21-6-5-20(2)11-13(21)12-22/h10,13H,3-9,11-12H2,1-2H3,(H2,17,18,19) |
| InChIKey | CEQSUFWXUFOPDW-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 61.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.51 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|