C20H21N3O4 — CID 72913559
8-(1-benzoxepine-4-carbonyl)-1-ethyl-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 72913559) has the molecular formula C20H21N3O4 and a molecular weight of 367.40 g/mol. Its IUPAC name is 8-(1-benzoxepine-4-carbonyl)-1-ethyl-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-(1-benzoxepine-4-carbonyl)-1-ethyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 72913559 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 8-(1-benzoxepine-4-carbonyl)-1-ethyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | CCN1C(=O)NC(=O)C12CCN(C(=O)C1=Cc3ccccc3OC=C1)CC2 |
| InChI | InChI=1S/C20H21N3O4/c1-2-23-19(26)21-18(25)20(23)8-10-22(11-9-20)17(24)15-7-12-27-16-6-4-3-5-14(16)13-15/h3-7,12-13H,2,8-11H2,1H3,(H,21,25,26) |
| InChIKey | CDWVIGJASBMEMB-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|