C17H25ClF2N2O — CID 72914257
3-[(3R,4S)-1-[(3-chloro-2,6-difluorophenyl)methyl]-4-(dimethylamino)piperidin-3-yl]propan-1-ol (PubChem CID 72914257) has the molecular formula C17H25ClF2N2O and a molecular weight of 346.85 g/mol. Its IUPAC name is 3-[(3R,4S)-1-[(3-chloro-2,6-difluorophenyl)methyl]-4-(dimethylamino)piperidin-3-yl]propan-1-ol.
| Compound Name | 3-[(3R,4S)-1-[(3-chloro-2,6-difluorophenyl)methyl]-4-(dimethylamino)piperidin-3-yl]propan-1-ol |
|---|---|
| PubChem CID | 72914257 |
| Molecular Formula | C17H25ClF2N2O |
| Molecular Weight | 346.85 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 3-[(3R,4S)-1-[(3-chloro-2,6-difluorophenyl)methyl]-4-(dimethylamino)piperidin-3-yl]propan-1-ol |
| SMILES | CN(C)[C@H]1CCN(Cc2c(F)ccc(Cl)c2F)C[C@H]1CCCO |
| InChI | InChI=1S/C17H25ClF2N2O/c1-21(2)16-7-8-22(10-12(16)4-3-9-23)11-13-15(19)6-5-14(18)17(13)20/h5-6,12,16,23H,3-4,7-11H2,1-2H3/t12-,16+/m1/s1 |
| InChIKey | DBYPTTMURKMRJY-WBMJQRKESA-N |
| XLogP | 3.14 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.85 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|