C20H21N5O3 — CID 72914526
4-(6-ethylpyrimidin-4-yl)-N-(4-oxochromen-6-yl)piperazine-1-carboxamide (PubChem CID 72914526) has the molecular formula C20H21N5O3 and a molecular weight of 379.42 g/mol. Its IUPAC name is 4-(6-ethylpyrimidin-4-yl)-N-(4-oxochromen-6-yl)piperazine-1-carboxamide.
| Compound Name | 4-(6-ethylpyrimidin-4-yl)-N-(4-oxochromen-6-yl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 72914526 |
| Molecular Formula | C20H21N5O3 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 4-(6-ethylpyrimidin-4-yl)-N-(4-oxochromen-6-yl)piperazine-1-carboxamide |
| SMILES | CCc1cc(N2CCN(C(=O)Nc3ccc4occc(=O)c4c3)CC2)ncn1 |
| InChI | InChI=1S/C20H21N5O3/c1-2-14-12-19(22-13-21-14)24-6-8-25(9-7-24)20(27)23-15-3-4-18-16(11-15)17(26)5-10-28-18/h3-5,10-13H,2,6-9H2,1H3,(H,23,27) |
| InChIKey | JBIJBHWGTOKVFY-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |