C17H20N6O3 — CID 72915812
1-[4-(3,7-dimethyl-2,6-dioxopurin-8-yl)phenyl]-3-propan-2-ylurea (PubChem CID 72915812) has the molecular formula C17H20N6O3 and a molecular weight of 356.39 g/mol. Its IUPAC name is 1-[4-(3,7-dimethyl-2,6-dioxopurin-8-yl)phenyl]-3-propan-2-ylurea.
| Compound Name | 1-[4-(3,7-dimethyl-2,6-dioxopurin-8-yl)phenyl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 72915812 |
| Molecular Formula | C17H20N6O3 |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 1-[4-(3,7-dimethyl-2,6-dioxopurin-8-yl)phenyl]-3-propan-2-ylurea |
| SMILES | CC(C)NC(=O)Nc1ccc(-c2nc3c(c(=O)[nH]c(=O)n3C)n2C)cc1 |
| InChI | InChI=1S/C17H20N6O3/c1-9(2)18-16(25)19-11-7-5-10(6-8-11)13-20-14-12(22(13)3)15(24)21-17(26)23(14)4/h5-9H,1-4H3,(H2,18,19,25)(H,21,24,26) |
| InChIKey | SMFWIXVZHVVAPT-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |