C17H22ClN3O2 — CID 72921513
1-[2-[3-(4-chlorophenyl)piperidin-1-yl]-2-oxoethyl]-3-methylimidazolidin-2-one (PubChem CID 72921513) has the molecular formula C17H22ClN3O2 and a molecular weight of 335.83 g/mol. Its IUPAC name is 1-[2-[3-(4-chlorophenyl)piperidin-1-yl]-2-oxoethyl]-3-methylimidazolidin-2-one.
| Compound Name | 1-[2-[3-(4-chlorophenyl)piperidin-1-yl]-2-oxoethyl]-3-methylimidazolidin-2-one |
|---|---|
| PubChem CID | 72921513 |
| Molecular Formula | C17H22ClN3O2 |
| Molecular Weight | 335.83 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 1-[2-[3-(4-chlorophenyl)piperidin-1-yl]-2-oxoethyl]-3-methylimidazolidin-2-one |
| SMILES | CN1CCN(CC(=O)N2CCCC(c3ccc(Cl)cc3)C2)C1=O |
| InChI | InChI=1S/C17H22ClN3O2/c1-19-9-10-21(17(19)23)12-16(22)20-8-2-3-14(11-20)13-4-6-15(18)7-5-13/h4-7,14H,2-3,8-12H2,1H3 |
| InChIKey | KQNMSVFFMCHTIU-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.83 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |