C20H23FN6O — CID 72922602
(3-fluoroimidazo[1,2-a]pyridin-2-yl)-[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)piperidin-1-yl]methanone (PubChem CID 72922602) has the molecular formula C20H23FN6O and a molecular weight of 382.44 g/mol. Its IUPAC name is (3-fluoroimidazo[1,2-a]pyridin-2-yl)-[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)piperidin-1-yl]methanone.
| Compound Name | (3-fluoroimidazo[1,2-a]pyridin-2-yl)-[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 72922602 |
| Molecular Formula | C20H23FN6O |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | (3-fluoroimidazo[1,2-a]pyridin-2-yl)-[4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)piperidin-1-yl]methanone |
| SMILES | O=C(c1nc2ccccn2c1F)N1CCC(c2nnc3n2CCCCC3)CC1 |
| InChI | InChI=1S/C20H23FN6O/c21-18-17(22-15-6-3-5-10-26(15)18)20(28)25-12-8-14(9-13-25)19-24-23-16-7-2-1-4-11-27(16)19/h3,5-6,10,14H,1-2,4,7-9,11-13H2 |
| InChIKey | AAXNXHZGLFPAQC-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 68.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |