C12H16N4O3S — CID 72923330
4-[[(5-propyl-1,3,4-oxadiazol-2-yl)amino]methyl]benzenesulfonamide (PubChem CID 72923330) has the molecular formula C12H16N4O3S and a molecular weight of 296.35 g/mol. Its IUPAC name is 4-[[(5-propyl-1,3,4-oxadiazol-2-yl)amino]methyl]benzenesulfonamide.
| Compound Name | 4-[[(5-propyl-1,3,4-oxadiazol-2-yl)amino]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 72923330 |
| Molecular Formula | C12H16N4O3S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 4-[[(5-propyl-1,3,4-oxadiazol-2-yl)amino]methyl]benzenesulfonamide |
| SMILES | CCCc1nnc(NCc2ccc(S(N)(=O)=O)cc2)o1 |
| InChI | InChI=1S/C12H16N4O3S/c1-2-3-11-15-16-12(19-11)14-8-9-4-6-10(7-5-9)20(13,17)18/h4-7H,2-3,8H2,1H3,(H,14,16)(H2,13,17,18) |
| InChIKey | BKLIVSFDFOAVDA-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 111.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |