C16H20N4 — CID 72926252
3-[3-(2-ethyl-5-methyl-1,2,4-triazol-3-yl)propyl]-1H-indole (PubChem CID 72926252) has the molecular formula C16H20N4 and a molecular weight of 268.36 g/mol. Its IUPAC name is 3-[3-(2-ethyl-5-methyl-1,2,4-triazol-3-yl)propyl]-1H-indole.
| Compound Name | 3-[3-(2-ethyl-5-methyl-1,2,4-triazol-3-yl)propyl]-1H-indole |
|---|---|
| PubChem CID | 72926252 |
| Molecular Formula | C16H20N4 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 3-[3-(2-ethyl-5-methyl-1,2,4-triazol-3-yl)propyl]-1H-indole |
| SMILES | CCn1nc(C)nc1CCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C16H20N4/c1-3-20-16(18-12(2)19-20)10-6-7-13-11-17-15-9-5-4-8-14(13)15/h4-5,8-9,11,17H,3,6-7,10H2,1-2H3 |
| InChIKey | URDSWXNKFUWCST-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |