C15H17N5OS — CID 72926255
3,6-dimethyl-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)-[1,2]oxazolo[5,4-d]pyrimidin-4-amine (PubChem CID 72926255) has the molecular formula C15H17N5OS and a molecular weight of 315.40 g/mol. Its IUPAC name is 3,6-dimethyl-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)-[1,2]oxazolo[5,4-d]pyrimidin-4-amine.
| Compound Name | 3,6-dimethyl-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)-[1,2]oxazolo[5,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 72926255 |
| Molecular Formula | C15H17N5OS |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | 3,6-dimethyl-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)-[1,2]oxazolo[5,4-d]pyrimidin-4-amine |
| SMILES | Cc1nc(NCc2nc3c(s2)CCCC3)c2c(C)noc2n1 |
| InChI | InChI=1S/C15H17N5OS/c1-8-13-14(17-9(2)18-15(13)21-20-8)16-7-12-19-10-5-3-4-6-11(10)22-12/h3-7H2,1-2H3,(H,16,17,18) |
| InChIKey | YHQQDTBXJPVZEB-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 76.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |