C20H26N4O2S — CID 72928213
N-[[5-[(5-acetylthiophen-3-yl)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl]methyl]cyclobutanecarboxamide (PubChem CID 72928213) has the molecular formula C20H26N4O2S and a molecular weight of 386.52 g/mol. Its IUPAC name is N-[[5-[(5-acetylthiophen-3-yl)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl]methyl]cyclobutanecarboxamide.
| Compound Name | N-[[5-[(5-acetylthiophen-3-yl)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl]methyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 72928213 |
| Molecular Formula | C20H26N4O2S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | N-[[5-[(5-acetylthiophen-3-yl)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl]methyl]cyclobutanecarboxamide |
| SMILES | CC(=O)c1cc(CN2CCCn3nc(CNC(=O)C4CCC4)cc3C2)cs1 |
| InChI | InChI=1S/C20H26N4O2S/c1-14(25)19-8-15(13-27-19)11-23-6-3-7-24-18(12-23)9-17(22-24)10-21-20(26)16-4-2-5-16/h8-9,13,16H,2-7,10-12H2,1H3,(H,21,26) |
| InChIKey | VJBVVXWUYLRKJV-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |