C22H22N2O3 — CID 7293171
5-[2-(2,3-dihydroindol-1-yl)-2-oxoethoxy]-2-propylisoquinolin-1-one (PubChem CID 7293171) has the molecular formula C22H22N2O3 and a molecular weight of 362.43 g/mol. Its IUPAC name is 5-[2-(2,3-dihydroindol-1-yl)-2-oxoethoxy]-2-propylisoquinolin-1-one.
| Compound Name | 5-[2-(2,3-dihydroindol-1-yl)-2-oxoethoxy]-2-propylisoquinolin-1-one |
|---|---|
| PubChem CID | 7293171 |
| Molecular Formula | C22H22N2O3 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 5-[2-(2,3-dihydroindol-1-yl)-2-oxoethoxy]-2-propylisoquinolin-1-one |
| SMILES | CCCn1ccc2c(OCC(=O)N3CCc4ccccc43)cccc2c1=O |
| InChI | InChI=1S/C22H22N2O3/c1-2-12-23-13-11-17-18(22(23)26)7-5-9-20(17)27-15-21(25)24-14-10-16-6-3-4-8-19(16)24/h3-9,11,13H,2,10,12,14-15H2,1H3 |
| InChIKey | ILZKSDNQJWLXRF-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |