C11H13ClF2N2 — CID 72942295
N-[2-(benzylamino)ethyl]-2,2-difluoroethanimidoyl chloride (PubChem CID 72942295) has the molecular formula C11H13ClF2N2 and a molecular weight of 246.69 g/mol. Its IUPAC name is N-[2-(benzylamino)ethyl]-2,2-difluoroethanimidoyl chloride.
| Compound Name | N-[2-(benzylamino)ethyl]-2,2-difluoroethanimidoyl chloride |
|---|---|
| PubChem CID | 72942295 |
| Molecular Formula | C11H13ClF2N2 |
| Molecular Weight | 246.69 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | N-[2-(benzylamino)ethyl]-2,2-difluoroethanimidoyl chloride |
| SMILES | FC(F)/C(Cl)=N/CCNCc1ccccc1 |
| InChI | InChI=1S/C11H13ClF2N2/c12-10(11(13)14)16-7-6-15-8-9-4-2-1-3-5-9/h1-5,11,15H,6-8H2/b16-10- |
| InChIKey | PWHFJEGOKGKMBU-YBEGLDIGSA-N |
| XLogP | 2.68 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.69 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|