N-[2-(benzylamino)ethyl]-2,2-difluoroethanimidoyl chloride

C11H13ClF2N2 — CID 72942295

IUPACN-[2-(benzylamino)ethyl]-2,2-difluoroethanimidoyl chloride
SMILESFC(F)/C(Cl)=N/CCNCc1ccccc1
InChIInChI=1S/C11H13ClF2N2/c12-10(11(13)14)16-7-6-15-8-9-4-2-1-3-5-9/h1-5,11,15H,6-8H2/b16-10-
InChIKeyPWHFJEGOKGKMBU-YBEGLDIGSA-N
MW246.69 g/mol
LogP2.68
Rot. Bonds6

About N-[2-(benzylamino)ethyl]-2,2-difluoroethanimidoyl chloride

N-[2-(benzylamino)ethyl]-2,2-difluoroethanimidoyl chloride (PubChem CID 72942295) has the molecular formula C11H13ClF2N2 and a molecular weight of 246.69 g/mol. Its IUPAC name is N-[2-(benzylamino)ethyl]-2,2-difluoroethanimidoyl chloride.

Molecular Properties

Compound NameN-[2-(benzylamino)ethyl]-2,2-difluoroethanimidoyl chloride
PubChem CID72942295
Molecular FormulaC11H13ClF2N2
Molecular Weight246.69 g/mol
Exact Mass246.07
IUPAC NameN-[2-(benzylamino)ethyl]-2,2-difluoroethanimidoyl chloride
SMILESFC(F)/C(Cl)=N/CCNCc1ccccc1
InChIInChI=1S/C11H13ClF2N2/c12-10(11(13)14)16-7-6-15-8-9-4-2-1-3-5-9/h1-5,11,15H,6-8H2/b16-10-
InChIKeyPWHFJEGOKGKMBU-YBEGLDIGSA-N
XLogP2.68
TPSA24.39 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500246.69
LogP ≤ 52.68
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}

Analyze N-[2-(benzylamino)ethyl]-2,2-difluoroethanimidoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-[2-(benzylamino)ethyl]-2,2-difluoroethanimidoyl chloride?
The IUPAC name of N-[2-(benzylamino)ethyl]-2,2-difluoroethanimidoyl chloride (CID 72942295) is N-[2-(benzylamino)ethyl]-2,2-difluoroethanimidoyl chloride.
What is the SMILES notation for N-[2-(benzylamino)ethyl]-2,2-difluoroethanimidoyl chloride?
The canonical SMILES for N-[2-(benzylamino)ethyl]-2,2-difluoroethanimidoyl chloride is FC(F)/C(Cl)=N/CCNCc1ccccc1.
What is the InChIKey of N-[2-(benzylamino)ethyl]-2,2-difluoroethanimidoyl chloride?
The InChIKey is PWHFJEGOKGKMBU-YBEGLDIGSA-N. The full InChI is InChI=1S/C11H13ClF2N2/c12-10(11(13)14)16-7-6-15-8-9-4-2-1-3-5-9/h1-5,11,15H,6-8H2/b16-10-.
What are the key properties of N-[2-(benzylamino)ethyl]-2,2-difluoroethanimidoyl chloride?
N-[2-(benzylamino)ethyl]-2,2-difluoroethanimidoyl chloride has a molecular weight of 246.69 g/mol, XLogP of 2.68, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(benzylamino)ethyl]-2,2-difluoroethanimidoyl chloride is sourced from PubChem (CID 72942295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).