C21H17N3O7 — CID 72942325
3-(2-nitrophenyl)-1,1-bis(4-nitrophenyl)propan-1-ol (PubChem CID 72942325) has the molecular formula C21H17N3O7 and a molecular weight of 423.38 g/mol. Its IUPAC name is 3-(2-nitrophenyl)-1,1-bis(4-nitrophenyl)propan-1-ol.
| Compound Name | 3-(2-nitrophenyl)-1,1-bis(4-nitrophenyl)propan-1-ol |
|---|---|
| PubChem CID | 72942325 |
| Molecular Formula | C21H17N3O7 |
| Molecular Weight | 423.38 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | 3-(2-nitrophenyl)-1,1-bis(4-nitrophenyl)propan-1-ol |
| SMILES | O=[N+]([O-])c1ccc(C(O)(CCc2ccccc2[N+](=O)[O-])c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C21H17N3O7/c25-21(16-5-9-18(10-6-16)22(26)27,17-7-11-19(12-8-17)23(28)29)14-13-15-3-1-2-4-20(15)24(30)31/h1-12,25H,13-14H2 |
| InChIKey | UVMRIXDWLDHCSA-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 149.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.38 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|