C23H19BrF4N2O2 — CID 72944310
N-[4-(8-bromoquinolin-4-yl)oxycyclohexyl]-3-fluoro-4-(trifluoromethyl)benzamide (PubChem CID 72944310) has the molecular formula C23H19BrF4N2O2 and a molecular weight of 511.31 g/mol. Its IUPAC name is N-[4-(8-bromoquinolin-4-yl)oxycyclohexyl]-3-fluoro-4-(trifluoromethyl)benzamide.
| Compound Name | N-[4-(8-bromoquinolin-4-yl)oxycyclohexyl]-3-fluoro-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 72944310 |
| Molecular Formula | C23H19BrF4N2O2 |
| Molecular Weight | 511.31 g/mol |
| Exact Mass | 510.06 |
| IUPAC Name | N-[4-(8-bromoquinolin-4-yl)oxycyclohexyl]-3-fluoro-4-(trifluoromethyl)benzamide |
| SMILES | O=C(NC1CCC(Oc2ccnc3c(Br)cccc23)CC1)c1ccc(C(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C23H19BrF4N2O2/c24-18-3-1-2-16-20(10-11-29-21(16)18)32-15-7-5-14(6-8-15)30-22(31)13-4-9-17(19(25)12-13)23(26,27)28/h1-4,9-12,14-15H,5-8H2,(H,30,31) |
| InChIKey | SKHBRZUVHBVDFH-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.31 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |