C15H11ClN2O6S — CID 72962387
2-[2-[(4-chlorophenyl)methylsulfinyl]ethenyl]-4,6-dinitrophenol (PubChem CID 72962387) has the molecular formula C15H11ClN2O6S and a molecular weight of 382.78 g/mol. Its IUPAC name is 2-[2-[(4-chlorophenyl)methylsulfinyl]ethenyl]-4,6-dinitrophenol.
| Compound Name | 2-[2-[(4-chlorophenyl)methylsulfinyl]ethenyl]-4,6-dinitrophenol |
|---|---|
| PubChem CID | 72962387 |
| Molecular Formula | C15H11ClN2O6S |
| Molecular Weight | 382.78 g/mol |
| Exact Mass | 382.00 |
| IUPAC Name | 2-[2-[(4-chlorophenyl)methylsulfinyl]ethenyl]-4,6-dinitrophenol |
| SMILES | O=[N+]([O-])c1cc(C=CS(=O)Cc2ccc(Cl)cc2)c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H11ClN2O6S/c16-12-3-1-10(2-4-12)9-25(24)6-5-11-7-13(17(20)21)8-14(15(11)19)18(22)23/h1-8,19H,9H2 |
| InChIKey | IJBOKMUATXOHLW-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 123.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.78 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|