C26H48O3Si — CID 72971798
1-(6-ethyl-1-hydroxy-6-triethylsilyloxyoct-4-en-2-yl)-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-ol (PubChem CID 72971798) has the molecular formula C26H48O3Si and a molecular weight of 436.75 g/mol. Its IUPAC name is 1-(6-ethyl-1-hydroxy-6-triethylsilyloxyoct-4-en-2-yl)-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-ol.
| Compound Name | 1-(6-ethyl-1-hydroxy-6-triethylsilyloxyoct-4-en-2-yl)-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-ol |
|---|---|
| PubChem CID | 72971798 |
| Molecular Formula | C26H48O3Si |
| Molecular Weight | 436.75 g/mol |
| Exact Mass | 436.34 |
| IUPAC Name | 1-(6-ethyl-1-hydroxy-6-triethylsilyloxyoct-4-en-2-yl)-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-ol |
| SMILES | CCC(C=CCC(CO)C1=CCC2C(O)CCCC12C)(CC)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C26H48O3Si/c1-7-26(8-2,29-30(9-3,10-4)11-5)19-12-14-21(20-27)22-16-17-23-24(28)15-13-18-25(22,23)6/h12,16,19,21,23-24,27-28H,7-11,13-15,17-18,20H2,1-6H3 |
| InChIKey | BFTMRHKDCVFDDU-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.75 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|