C7H13FO2 — CID 72973949
3-fluoro-5-methylhex-5-ene-1,2-diol (PubChem CID 72973949) has the molecular formula C7H13FO2 and a molecular weight of 148.18 g/mol. Its IUPAC name is 3-fluoro-5-methylhex-5-ene-1,2-diol.
| Compound Name | 3-fluoro-5-methylhex-5-ene-1,2-diol |
|---|---|
| PubChem CID | 72973949 |
| Molecular Formula | C7H13FO2 |
| Molecular Weight | 148.18 g/mol |
| Exact Mass | 148.09 |
| IUPAC Name | 3-fluoro-5-methylhex-5-ene-1,2-diol |
| SMILES | C=C(C)CC(F)C(O)CO |
| InChI | InChI=1S/C7H13FO2/c1-5(2)3-6(8)7(10)4-9/h6-7,9-10H,1,3-4H2,2H3 |
| InChIKey | ALJSHFUDNXNQJX-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.18 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|