C23H31NO6 — CID 7297778
N-[(2R)-3-(4-tert-butylphenoxy)-2-hydroxypropyl]-3,4,5-trimethoxybenzamide (PubChem CID 7297778) has the molecular formula C23H31NO6 and a molecular weight of 417.50 g/mol. Its IUPAC name is N-[(2R)-3-(4-tert-butylphenoxy)-2-hydroxypropyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[(2R)-3-(4-tert-butylphenoxy)-2-hydroxypropyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 7297778 |
| Molecular Formula | C23H31NO6 |
| Molecular Weight | 417.50 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | N-[(2R)-3-(4-tert-butylphenoxy)-2-hydroxypropyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NC[C@@H](O)COc2ccc(C(C)(C)C)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C23H31NO6/c1-23(2,3)16-7-9-18(10-8-16)30-14-17(25)13-24-22(26)15-11-19(27-4)21(29-6)20(12-15)28-5/h7-12,17,25H,13-14H2,1-6H3,(H,24,26)/t17-/m1/s1 |
| InChIKey | HDWXJLZRVRVNHA-QGZVFWFLSA-N |
| XLogP | 3.18 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.50 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |