C21H28N2O4 — CID 121495478
1-[3-(4-tert-butylphenoxy)-2-hydroxypropyl]-3-[(4-hydroxyphenyl)methyl]urea (PubChem CID 121495478) has the molecular formula C21H28N2O4 and a molecular weight of 372.47 g/mol. Its IUPAC name is 1-[3-(4-tert-butylphenoxy)-2-hydroxypropyl]-3-[(4-hydroxyphenyl)methyl]urea.
| Compound Name | 1-[3-(4-tert-butylphenoxy)-2-hydroxypropyl]-3-[(4-hydroxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 121495478 |
| Molecular Formula | C21H28N2O4 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | 1-[3-(4-tert-butylphenoxy)-2-hydroxypropyl]-3-[(4-hydroxyphenyl)methyl]urea |
| SMILES | CC(C)(C)c1ccc(OCC(O)CNC(=O)NCc2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C21H28N2O4/c1-21(2,3)16-6-10-19(11-7-16)27-14-18(25)13-23-20(26)22-12-15-4-8-17(24)9-5-15/h4-11,18,24-25H,12-14H2,1-3H3,(H2,22,23,26) |
| InChIKey | RYOATZNXIXKLGH-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |