C17H14O4 — CID 72993634
[1-(3-methyl-2,5-dioxocyclopent-3-en-1-ylidene)-3-phenylprop-2-enyl] acetate (PubChem CID 72993634) has the molecular formula C17H14O4 and a molecular weight of 282.30 g/mol. Its IUPAC name is [1-(3-methyl-2,5-dioxocyclopent-3-en-1-ylidene)-3-phenylprop-2-enyl] acetate.
| Compound Name | [1-(3-methyl-2,5-dioxocyclopent-3-en-1-ylidene)-3-phenylprop-2-enyl] acetate |
|---|---|
| PubChem CID | 72993634 |
| Molecular Formula | C17H14O4 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | [1-(3-methyl-2,5-dioxocyclopent-3-en-1-ylidene)-3-phenylprop-2-enyl] acetate |
| SMILES | CC(=O)OC(C=Cc1ccccc1)=C1C(=O)C=C(C)C1=O |
| InChI | InChI=1S/C17H14O4/c1-11-10-14(19)16(17(11)20)15(21-12(2)18)9-8-13-6-4-3-5-7-13/h3-10H,1-2H3 |
| InChIKey | LSTFWGDTUNPCNN-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|