C14H18N2O3S — CID 7300416
ethyl (1R,5S)-1-cyano-2-oxo-4-sulfanylidene-3-azaspiro[5.5]undecane-5-carboxylate (PubChem CID 7300416) has the molecular formula C14H18N2O3S and a molecular weight of 294.38 g/mol. Its IUPAC name is ethyl (1R,5S)-1-cyano-2-oxo-4-sulfanylidene-3-azaspiro[5.5]undecane-5-carboxylate.
| Compound Name | ethyl (1R,5S)-1-cyano-2-oxo-4-sulfanylidene-3-azaspiro[5.5]undecane-5-carboxylate |
|---|---|
| PubChem CID | 7300416 |
| Molecular Formula | C14H18N2O3S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | ethyl (1R,5S)-1-cyano-2-oxo-4-sulfanylidene-3-azaspiro[5.5]undecane-5-carboxylate |
| SMILES | CCOC(=O)[C@H]1C(=S)NC(=O)[C@@H](C#N)C12CCCCC2 |
| InChI | InChI=1S/C14H18N2O3S/c1-2-19-13(18)10-12(20)16-11(17)9(8-15)14(10)6-4-3-5-7-14/h9-10H,2-7H2,1H3,(H,16,17,20)/t9-,10-/m1/s1 |
| InChIKey | PMRXCQSAOKXJGK-NXEZZACHSA-N |
| XLogP | 1.71 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|