C25H38N4O6S — CID 73005375
(1-methylpyrrolidin-2-yl)methyl 4-(hydroxycarbamoyl)-4-[(4-phenylpiperidin-1-yl)sulfonylmethyl]piperidine-1-carboxylate (PubChem CID 73005375) has the molecular formula C25H38N4O6S and a molecular weight of 522.67 g/mol. Its IUPAC name is (1-methylpyrrolidin-2-yl)methyl 4-(hydroxycarbamoyl)-4-[(4-phenylpiperidin-1-yl)sulfonylmethyl]piperidine-1-carboxylate.
| Compound Name | (1-methylpyrrolidin-2-yl)methyl 4-(hydroxycarbamoyl)-4-[(4-phenylpiperidin-1-yl)sulfonylmethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 73005375 |
| Molecular Formula | C25H38N4O6S |
| Molecular Weight | 522.67 g/mol |
| Exact Mass | 522.25 |
| IUPAC Name | (1-methylpyrrolidin-2-yl)methyl 4-(hydroxycarbamoyl)-4-[(4-phenylpiperidin-1-yl)sulfonylmethyl]piperidine-1-carboxylate |
| SMILES | CN1CCCC1COC(=O)N1CCC(CS(=O)(=O)N2CCC(c3ccccc3)CC2)(C(=O)NO)CC1 |
| InChI | InChI=1S/C25H38N4O6S/c1-27-13-5-8-22(27)18-35-24(31)28-16-11-25(12-17-28,23(30)26-32)19-36(33,34)29-14-9-21(10-15-29)20-6-3-2-4-7-20/h2-4,6-7,21-22,32H,5,8-19H2,1H3,(H,26,30) |
| InChIKey | KSNYVXITKCMHTR-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 119.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.67 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|