C20H26F3N3O6S — CID 91319180
4-(hydroxycarbamoyl)-4-[[4-[2-(trifluoromethyl)phenyl]piperidin-1-yl]sulfonylmethyl]piperidine-1-carboxylic acid (PubChem CID 91319180) has the molecular formula C20H26F3N3O6S and a molecular weight of 493.50 g/mol. Its IUPAC name is 4-(hydroxycarbamoyl)-4-[[4-[2-(trifluoromethyl)phenyl]piperidin-1-yl]sulfonylmethyl]piperidine-1-carboxylic acid.
| Compound Name | 4-(hydroxycarbamoyl)-4-[[4-[2-(trifluoromethyl)phenyl]piperidin-1-yl]sulfonylmethyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 91319180 |
| Molecular Formula | C20H26F3N3O6S |
| Molecular Weight | 493.50 g/mol |
| Exact Mass | 493.15 |
| IUPAC Name | 4-(hydroxycarbamoyl)-4-[[4-[2-(trifluoromethyl)phenyl]piperidin-1-yl]sulfonylmethyl]piperidine-1-carboxylic acid |
| SMILES | O=C(O)N1CCC(CS(=O)(=O)N2CCC(c3ccccc3C(F)(F)F)CC2)(C(=O)NO)CC1 |
| InChI | InChI=1S/C20H26F3N3O6S/c21-20(22,23)16-4-2-1-3-15(16)14-5-9-26(10-6-14)33(31,32)13-19(17(27)24-30)7-11-25(12-8-19)18(28)29/h1-4,14,30H,5-13H2,(H,24,27)(H,28,29) |
| InChIKey | OEPCOKLQOPAYRK-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 127.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.50 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|