C20H18FN3O4 — CID 7300871
ethyl (2S,3E)-1-(4-fluorophenyl)-2-methyl-4,5-dioxo-3-(phenylhydrazinylidene)pyrrolidine-2-carboxylate (PubChem CID 7300871) has the molecular formula C20H18FN3O4 and a molecular weight of 383.38 g/mol. Its IUPAC name is ethyl (2S,3E)-1-(4-fluorophenyl)-2-methyl-4,5-dioxo-3-(phenylhydrazinylidene)pyrrolidine-2-carboxylate.
| Compound Name | ethyl (2S,3E)-1-(4-fluorophenyl)-2-methyl-4,5-dioxo-3-(phenylhydrazinylidene)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 7300871 |
| Molecular Formula | C20H18FN3O4 |
| Molecular Weight | 383.38 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | ethyl (2S,3E)-1-(4-fluorophenyl)-2-methyl-4,5-dioxo-3-(phenylhydrazinylidene)pyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)[C@]1(C)/C(=N\Nc2ccccc2)C(=O)C(=O)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C20H18FN3O4/c1-3-28-19(27)20(2)17(23-22-14-7-5-4-6-8-14)16(25)18(26)24(20)15-11-9-13(21)10-12-15/h4-12,22H,3H2,1-2H3/b23-17-/t20-/m0/s1 |
| InChIKey | IGDQTFORXYTTIR-MCIDSYJDSA-N |
| XLogP | 2.53 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.38 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|