C23H14N4O2S — CID 7301279
(3S)-1-phenyl-3-(11,12,14-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5(16),6,8,10(15),11,13-octaen-13-ylsulfanyl)pyrrolidine-2,5-dione (PubChem CID 7301279) has the molecular formula C23H14N4O2S and a molecular weight of 410.46 g/mol. Its IUPAC name is (3S)-1-phenyl-3-(11,12,14-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5(16),6,8,10(15),11,13-octaen-13-ylsulfanyl)pyrrolidine-2,5-dione.
| Compound Name | (3S)-1-phenyl-3-(11,12,14-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5(16),6,8,10(15),11,13-octaen-13-ylsulfanyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 7301279 |
| Molecular Formula | C23H14N4O2S |
| Molecular Weight | 410.46 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | (3S)-1-phenyl-3-(11,12,14-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5(16),6,8,10(15),11,13-octaen-13-ylsulfanyl)pyrrolidine-2,5-dione |
| SMILES | O=C1C[C@H](Sc2nnc3c(n2)-c2cccc4cccc-3c24)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C23H14N4O2S/c28-18-12-17(22(29)27(18)14-8-2-1-3-9-14)30-23-24-20-15-10-4-6-13-7-5-11-16(19(13)15)21(20)25-26-23/h1-11,17H,12H2/t17-/m0/s1 |
| InChIKey | MVHGWCNOJIRELZ-KRWDZBQOSA-N |
| XLogP | 4.10 |
| TPSA | 76.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.46 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|