C20H14N4O4S — CID 23102365
3-[[6-(1,3-benzodioxol-5-yl)-1,2,4-triazin-3-yl]sulfanyl]-1-phenylpyrrolidine-2,5-dione (PubChem CID 23102365) has the molecular formula C20H14N4O4S and a molecular weight of 406.42 g/mol. Its IUPAC name is 3-[[6-(1,3-benzodioxol-5-yl)-1,2,4-triazin-3-yl]sulfanyl]-1-phenylpyrrolidine-2,5-dione.
| Compound Name | 3-[[6-(1,3-benzodioxol-5-yl)-1,2,4-triazin-3-yl]sulfanyl]-1-phenylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 23102365 |
| Molecular Formula | C20H14N4O4S |
| Molecular Weight | 406.42 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | 3-[[6-(1,3-benzodioxol-5-yl)-1,2,4-triazin-3-yl]sulfanyl]-1-phenylpyrrolidine-2,5-dione |
| SMILES | O=C1CC(Sc2ncc(-c3ccc4c(c3)OCO4)nn2)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C20H14N4O4S/c25-18-9-17(19(26)24(18)13-4-2-1-3-5-13)29-20-21-10-14(22-23-20)12-6-7-15-16(8-12)28-11-27-15/h1-8,10,17H,9,11H2 |
| InChIKey | HKIKODAUHXXYJQ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 94.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.42 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|