C13H12Cl2O8 — CID 7302443
(2S,3S,5R,6S)-1,7-dichloro-4-methylbicyclo[2.2.2]oct-7-ene-2,3,5,6-tetracarboxylic acid (PubChem CID 7302443) has the molecular formula C13H12Cl2O8 and a molecular weight of 367.14 g/mol. Its IUPAC name is (2S,3S,5R,6S)-1,7-dichloro-4-methylbicyclo[2.2.2]oct-7-ene-2,3,5,6-tetracarboxylic acid.
| Compound Name | (2S,3S,5R,6S)-1,7-dichloro-4-methylbicyclo[2.2.2]oct-7-ene-2,3,5,6-tetracarboxylic acid |
|---|---|
| PubChem CID | 7302443 |
| Molecular Formula | C13H12Cl2O8 |
| Molecular Weight | 367.14 g/mol |
| Exact Mass | 365.99 |
| IUPAC Name | (2S,3S,5R,6S)-1,7-dichloro-4-methylbicyclo[2.2.2]oct-7-ene-2,3,5,6-tetracarboxylic acid |
| SMILES | CC12C=C(Cl)C(Cl)([C@H](C(=O)O)[C@H]1C(=O)O)[C@H](C(=O)O)[C@@H]2C(=O)O |
| InChI | InChI=1S/C13H12Cl2O8/c1-12-2-3(14)13(15,6(10(20)21)4(12)8(16)17)7(11(22)23)5(12)9(18)19/h2,4-7H,1H3,(H,16,17)(H,18,19)(H,20,21)(H,22,23)/t4-,5+,6-,7-,12?,13?/m0/s1 |
| InChIKey | GAUWFYWDNGIVSY-SJCWSRECSA-N |
| XLogP | 0.92 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.14 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|