C29H28N2O11S — CID 73054717
1-[(5S,5aS,8aR,9R)-9-(4-hydroxy-3,5-dimethoxyphenyl)-8-oxo-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl]-3-(4-methoxyphenyl)sulfonylurea (PubChem CID 73054717) has the molecular formula C29H28N2O11S and a molecular weight of 612.61 g/mol. Its IUPAC name is 1-[(5S,5aS,8aR,9R)-9-(4-hydroxy-3,5-dimethoxyphenyl)-8-oxo-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl]-3-(4-methoxyphenyl)sulfonylurea.
| Compound Name | 1-[(5S,5aS,8aR,9R)-9-(4-hydroxy-3,5-dimethoxyphenyl)-8-oxo-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl]-3-(4-methoxyphenyl)sulfonylurea |
|---|---|
| PubChem CID | 73054717 |
| Molecular Formula | C29H28N2O11S |
| Molecular Weight | 612.61 g/mol |
| Exact Mass | 612.14 |
| IUPAC Name | 1-[(5S,5aS,8aR,9R)-9-(4-hydroxy-3,5-dimethoxyphenyl)-8-oxo-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl]-3-(4-methoxyphenyl)sulfonylurea |
| SMILES | COc1ccc(S(=O)(=O)NC(=O)N[C@@H]2c3cc4c(cc3[C@@H](c3cc(OC)c(O)c(OC)c3)[C@H]3C(=O)OC[C@@H]32)OCO4)cc1 |
| InChI | InChI=1S/C29H28N2O11S/c1-37-15-4-6-16(7-5-15)43(35,36)31-29(34)30-26-18-11-21-20(41-13-42-21)10-17(18)24(25-19(26)12-40-28(25)33)14-8-22(38-2)27(32)23(9-14)39-3/h4-11,19,24-26,32H,12-13H2,1-3H3,(H2,30,31,34)/t19-,24+,25-,26+/m0/s1 |
| InChIKey | VVUCWSMRFDUYGK-QNMIOERPSA-N |
| XLogP | 2.81 |
| TPSA | 167.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.61 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |