C13H14N2O7 — CID 73057305
methyl 1-(1-methoxy-1,2-dioxohex-5-en-3-yl)-4-nitropyrrole-2-carboxylate (PubChem CID 73057305) has the molecular formula C13H14N2O7 and a molecular weight of 310.26 g/mol. Its IUPAC name is methyl 1-(1-methoxy-1,2-dioxohex-5-en-3-yl)-4-nitropyrrole-2-carboxylate.
| Compound Name | methyl 1-(1-methoxy-1,2-dioxohex-5-en-3-yl)-4-nitropyrrole-2-carboxylate |
|---|---|
| PubChem CID | 73057305 |
| Molecular Formula | C13H14N2O7 |
| Molecular Weight | 310.26 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | methyl 1-(1-methoxy-1,2-dioxohex-5-en-3-yl)-4-nitropyrrole-2-carboxylate |
| SMILES | C=CCC(C(=O)C(=O)OC)n1cc([N+](=O)[O-])cc1C(=O)OC |
| InChI | InChI=1S/C13H14N2O7/c1-4-5-9(11(16)13(18)22-3)14-7-8(15(19)20)6-10(14)12(17)21-2/h4,6-7,9H,1,5H2,2-3H3 |
| InChIKey | XRNPHQMPLMSGLL-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 117.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.26 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|