C28H38N4O5 — CID 73058295
(2R)-2-[[formyl(hydroxy)amino]methyl]-N-[(2S)-1-(4-morpholin-4-ylanilino)-1-oxo-4-phenylbutan-2-yl]hexanamide (PubChem CID 73058295) has the molecular formula C28H38N4O5 and a molecular weight of 510.64 g/mol. Its IUPAC name is (2R)-2-[[formyl(hydroxy)amino]methyl]-N-[(2S)-1-(4-morpholin-4-ylanilino)-1-oxo-4-phenylbutan-2-yl]hexanamide.
| Compound Name | (2R)-2-[[formyl(hydroxy)amino]methyl]-N-[(2S)-1-(4-morpholin-4-ylanilino)-1-oxo-4-phenylbutan-2-yl]hexanamide |
|---|---|
| PubChem CID | 73058295 |
| Molecular Formula | C28H38N4O5 |
| Molecular Weight | 510.64 g/mol |
| Exact Mass | 510.28 |
| IUPAC Name | (2R)-2-[[formyl(hydroxy)amino]methyl]-N-[(2S)-1-(4-morpholin-4-ylanilino)-1-oxo-4-phenylbutan-2-yl]hexanamide |
| SMILES | CCCC[C@H](CN(O)C=O)C(=O)N[C@@H](CCc1ccccc1)C(=O)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C28H38N4O5/c1-2-3-9-23(20-32(36)21-33)27(34)30-26(15-10-22-7-5-4-6-8-22)28(35)29-24-11-13-25(14-12-24)31-16-18-37-19-17-31/h4-8,11-14,21,23,26,36H,2-3,9-10,15-20H2,1H3,(H,29,35)(H,30,34)/t23-,26+/m1/s1 |
| InChIKey | WNGNRYKPTIFZIR-BVAGGSTKSA-N |
| XLogP | 3.23 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.64 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|