C22H23N3O2 — CID 7306464
(3R,3aR,9aR)-3-acetyl-1-(4-methylphenyl)-4-prop-2-enyl-3,3a,9,9a-tetrahydropyrrolo[2,3-b]quinoxalin-2-one (PubChem CID 7306464) has the molecular formula C22H23N3O2 and a molecular weight of 361.45 g/mol. Its IUPAC name is (3R,3aR,9aR)-3-acetyl-1-(4-methylphenyl)-4-prop-2-enyl-3,3a,9,9a-tetrahydropyrrolo[2,3-b]quinoxalin-2-one.
| Compound Name | (3R,3aR,9aR)-3-acetyl-1-(4-methylphenyl)-4-prop-2-enyl-3,3a,9,9a-tetrahydropyrrolo[2,3-b]quinoxalin-2-one |
|---|---|
| PubChem CID | 7306464 |
| Molecular Formula | C22H23N3O2 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | (3R,3aR,9aR)-3-acetyl-1-(4-methylphenyl)-4-prop-2-enyl-3,3a,9,9a-tetrahydropyrrolo[2,3-b]quinoxalin-2-one |
| SMILES | C=CCN1c2ccccc2N[C@H]2[C@H]1[C@H](C(C)=O)C(=O)N2c1ccc(C)cc1 |
| InChI | InChI=1S/C22H23N3O2/c1-4-13-24-18-8-6-5-7-17(18)23-21-20(24)19(15(3)26)22(27)25(21)16-11-9-14(2)10-12-16/h4-12,19-21,23H,1,13H2,2-3H3/t19-,20+,21+/m0/s1 |
| InChIKey | VWGVBEZKZHABEQ-PWRODBHTSA-N |
| XLogP | 3.36 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|